C9H10INO2 — CID 131002588
(3R)-4-iodo-6-methoxy-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 131002588) has the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. Its IUPAC name is (3R)-4-iodo-6-methoxy-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | (3R)-4-iodo-6-methoxy-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 131002588 |
| Molecular Formula | C9H10INO2 |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | (3R)-4-iodo-6-methoxy-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | COc1cc(I)c2c(c1)OC[C@@H]2N |
| InChI | InChI=1S/C9H10INO2/c1-12-5-2-6(10)9-7(11)4-13-8(9)3-5/h2-3,7H,4,11H2,1H3/t7-/m0/s1 |
| InChIKey | BZUNSVNKTBARBH-ZETCQYMHSA-N |
| XLogP | 1.69 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|