C9H10INO — CID 131165587
(3R)-5-iodo-4-methyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 131165587) has the molecular formula C9H10INO and a molecular weight of 275.09 g/mol. Its IUPAC name is (3R)-5-iodo-4-methyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | (3R)-5-iodo-4-methyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 131165587 |
| Molecular Formula | C9H10INO |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | (3R)-5-iodo-4-methyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | Cc1c(I)ccc2c1[C@@H](N)CO2 |
| InChI | InChI=1S/C9H10INO/c1-5-6(10)2-3-8-9(5)7(11)4-12-8/h2-3,7H,4,11H2,1H3/t7-/m0/s1 |
| InChIKey | CFOWULSPUQBKQY-ZETCQYMHSA-N |
| XLogP | 1.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|