C9H11NO3 — CID 130665432
(3R)-3-amino-4-methoxy-2,3-dihydro-1-benzofuran-5-ol (PubChem CID 130665432) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is (3R)-3-amino-4-methoxy-2,3-dihydro-1-benzofuran-5-ol.
| Compound Name | (3R)-3-amino-4-methoxy-2,3-dihydro-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 130665432 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (3R)-3-amino-4-methoxy-2,3-dihydro-1-benzofuran-5-ol |
| SMILES | COc1c(O)ccc2c1[C@@H](N)CO2 |
| InChI | InChI=1S/C9H11NO3/c1-12-9-6(11)2-3-7-8(9)5(10)4-13-7/h2-3,5,11H,4,10H2,1H3/t5-/m0/s1 |
| InChIKey | RRBGOEXCVUGQIA-YFKPBYRVSA-N |
| XLogP | 0.79 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |