About 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol
3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol (PubChem CID 86192290) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol.
Molecular Properties
| Compound Name | 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol |
| PubChem CID | 86192290 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol |
| SMILES | COc1c(O)cc2c(c1OC)OCC2N |
| InChI | InChI=1S/C10H13NO4/c1-13-9-7(12)3-5-6(11)4-15-8(5)10(9)14-2/h3,6,12H,4,11H2,1-2H3 |
| InChIKey | XHVMZOGXWPNTEM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol?
The IUPAC name of 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol (CID 86192290) is 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol.
What is the SMILES notation for 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol?
The canonical SMILES for 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol is COc1c(O)cc2c(c1OC)OCC2N.
What is the InChIKey of 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol?
The InChIKey is XHVMZOGXWPNTEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c1-13-9-7(12)3-5-6(11)4-15-8(5)10(9)14-2/h3,6,12H,4,11H2,1-2H3.
What are the key properties of 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol?
3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol has a molecular weight of 211.22 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,7-dimethoxy-2,3-dihydro-1-benzofuran-5-ol is sourced from PubChem (CID 86192290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).