C20H22O8 — CID 95224887
(6aR,11aR)-2,3,4,9,10-pentamethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-ol (PubChem CID 95224887) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is (6aR,11aR)-2,3,4,9,10-pentamethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-ol.
| Compound Name | (6aR,11aR)-2,3,4,9,10-pentamethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-ol |
|---|---|
| PubChem CID | 95224887 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (6aR,11aR)-2,3,4,9,10-pentamethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-ol |
| SMILES | COc1cc2c(c(OC)c1OC)OC[C@H]1c3cc(O)c(OC)c(OC)c3O[C@@H]21 |
| InChI | InChI=1S/C20H22O8/c1-22-13-7-10-14-11(8-27-15(10)19(25-4)18(13)24-3)9-6-12(21)17(23-2)20(26-5)16(9)28-14/h6-7,11,14,21H,8H2,1-5H3/t11-,14-/m0/s1 |
| InChIKey | YBVIOLRRXMAGAE-FZMZJTMJSA-N |
| XLogP | 3.04 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |