C21H22O8 — CID 162955763
(3,4,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-yl) acetate (PubChem CID 162955763) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is (3,4,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-yl) acetate.
| Compound Name | (3,4,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-yl) acetate |
|---|---|
| PubChem CID | 162955763 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (3,4,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-8-yl) acetate |
| SMILES | COc1ccc2c(c1OC)OCC1c3cc(OC(C)=O)c(OC)c(OC)c3OC21 |
| InChI | InChI=1S/C21H22O8/c1-10(22)28-15-8-12-13-9-27-17-11(6-7-14(23-2)19(17)24-3)16(13)29-18(12)21(26-5)20(15)25-4/h6-8,13,16H,9H2,1-5H3 |
| InChIKey | OCORPZWADWHSGR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|