C27H32O4 — CID 163020714
(6aS,11aS)-3,9-dimethoxy-4,8-bis(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene (PubChem CID 163020714) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is (6aS,11aS)-3,9-dimethoxy-4,8-bis(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene.
| Compound Name | (6aS,11aS)-3,9-dimethoxy-4,8-bis(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene |
|---|---|
| PubChem CID | 163020714 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (6aS,11aS)-3,9-dimethoxy-4,8-bis(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene |
| SMILES | COc1cc2c(cc1CC=C(C)C)[C@H]1COc3c(ccc(OC)c3CC=C(C)C)[C@H]1O2 |
| InChI | InChI=1S/C27H32O4/c1-16(2)7-9-18-13-21-22-15-30-26-19(10-8-17(3)4)23(28-5)12-11-20(26)27(22)31-25(21)14-24(18)29-6/h7-8,11-14,22,27H,9-10,15H2,1-6H3/t22-,27-/m1/s1 |
| InChIKey | FRRIDYJLRAVGPK-AJTFRIOCSA-N |
| XLogP | 6.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|