C13H18O2 — CID 54284542
1,3-dimethoxy-2-(3-methylbut-2-enyl)benzene (PubChem CID 54284542) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1,3-dimethoxy-2-(3-methylbut-2-enyl)benzene.
| Compound Name | 1,3-dimethoxy-2-(3-methylbut-2-enyl)benzene |
|---|---|
| PubChem CID | 54284542 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1,3-dimethoxy-2-(3-methylbut-2-enyl)benzene |
| SMILES | COc1cccc(OC)c1CC=C(C)C |
| InChI | InChI=1S/C13H18O2/c1-10(2)8-9-11-12(14-3)6-5-7-13(11)15-4/h5-8H,9H2,1-4H3 |
| InChIKey | RTEHSDRXZHXXTG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|