C15H22O3 — CID 10586794
(2E)-2-[2-(2,6-dimethoxyphenyl)ethylidene]pentan-1-ol (PubChem CID 10586794) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2E)-2-[2-(2,6-dimethoxyphenyl)ethylidene]pentan-1-ol.
| Compound Name | (2E)-2-[2-(2,6-dimethoxyphenyl)ethylidene]pentan-1-ol |
|---|---|
| PubChem CID | 10586794 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2E)-2-[2-(2,6-dimethoxyphenyl)ethylidene]pentan-1-ol |
| SMILES | CCC/C(=C\Cc1c(OC)cccc1OC)CO |
| InChI | InChI=1S/C15H22O3/c1-4-6-12(11-16)9-10-13-14(17-2)7-5-8-15(13)18-3/h5,7-9,16H,4,6,10-11H2,1-3H3/b12-9+ |
| InChIKey | STAREORAVQQGHB-FMIVXFBMSA-N |
| XLogP | 2.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|