C13H16O4 — CID 135001864
[(E)-3-(2,6-dimethoxyphenyl)prop-1-enyl] acetate (PubChem CID 135001864) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is [(E)-3-(2,6-dimethoxyphenyl)prop-1-enyl] acetate.
| Compound Name | [(E)-3-(2,6-dimethoxyphenyl)prop-1-enyl] acetate |
|---|---|
| PubChem CID | 135001864 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [(E)-3-(2,6-dimethoxyphenyl)prop-1-enyl] acetate |
| SMILES | COc1cccc(OC)c1C/C=C/OC(C)=O |
| InChI | InChI=1S/C13H16O4/c1-10(14)17-9-5-6-11-12(15-2)7-4-8-13(11)16-3/h4-5,7-9H,6H2,1-3H3/b9-5+ |
| InChIKey | XYVNQXGUXWZXKG-WEVVVXLNSA-N |
| XLogP | 2.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|