C11H15NO3 — CID 18718180
N-[(2,6-dimethoxyphenyl)methyl]acetamide (PubChem CID 18718180) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is N-[(2,6-dimethoxyphenyl)methyl]acetamide.
| Compound Name | N-[(2,6-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 18718180 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-[(2,6-dimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cccc(OC)c1CNC(C)=O |
| InChI | InChI=1S/C11H15NO3/c1-8(13)12-7-9-10(14-2)5-4-6-11(9)15-3/h4-6H,7H2,1-3H3,(H,12,13) |
| InChIKey | KOFRPILEEFGDBE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |