C12H15BrO2 — CID 171049127
3-bromo-6-methoxy-2-(3-methylbut-2-enyl)phenol (PubChem CID 171049127) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is 3-bromo-6-methoxy-2-(3-methylbut-2-enyl)phenol.
| Compound Name | 3-bromo-6-methoxy-2-(3-methylbut-2-enyl)phenol |
|---|---|
| PubChem CID | 171049127 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 3-bromo-6-methoxy-2-(3-methylbut-2-enyl)phenol |
| SMILES | COc1ccc(Br)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C12H15BrO2/c1-8(2)4-5-9-10(13)6-7-11(15-3)12(9)14/h4,6-7,14H,5H2,1-3H3 |
| InChIKey | RNDWLASQLRITNO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|