C19H24O3 — CID 23110639
(2E)-1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-5-methylhexa-2,4-dien-1-one (PubChem CID 23110639) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2E)-1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-5-methylhexa-2,4-dien-1-one.
| Compound Name | (2E)-1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-5-methylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 23110639 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (2E)-1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-5-methylhexa-2,4-dien-1-one |
| SMILES | COc1ccc(C(=O)/C=C/C=C(C)C)c(O)c1CC=C(C)C |
| InChI | InChI=1S/C19H24O3/c1-13(2)7-6-8-17(20)15-11-12-18(22-5)16(19(15)21)10-9-14(3)4/h6-9,11-12,21H,10H2,1-5H3/b8-6+ |
| InChIKey | RMISPNIGFJGQJY-SOFGYWHQSA-N |
| XLogP | 4.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|