C36H56N2O4+2 — CID 155725208
5-[4-[(E)-3-[2-hydroxy-3-(3-methylbut-2-enyl)-4-[5-(trimethylazaniumyl)pentoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]pentyl-trimethylazanium (PubChem CID 155725208) has the molecular formula C36H56N2O4+2 and a molecular weight of 580.85 g/mol. Its IUPAC name is 5-[4-[(E)-3-[2-hydroxy-3-(3-methylbut-2-enyl)-4-[5-(trimethylazaniumyl)pentoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]pentyl-trimethylazanium.
| Compound Name | 5-[4-[(E)-3-[2-hydroxy-3-(3-methylbut-2-enyl)-4-[5-(trimethylazaniumyl)pentoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]pentyl-trimethylazanium |
|---|---|
| PubChem CID | 155725208 |
| Molecular Formula | C36H56N2O4+2 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.42 |
| IUPAC Name | 5-[4-[(E)-3-[2-hydroxy-3-(3-methylbut-2-enyl)-4-[5-(trimethylazaniumyl)pentoxy]phenyl]-3-oxoprop-1-enyl]phenoxy]pentyl-trimethylazanium |
| SMILES | CC(C)=CCc1c(OCCCCC[N+](C)(C)C)ccc(C(=O)/C=C/c2ccc(OCCCCC[N+](C)(C)C)cc2)c1O |
| InChI | InChI=1S/C36H55N2O4/c1-29(2)15-21-33-35(42-28-14-10-12-26-38(6,7)8)24-22-32(36(33)40)34(39)23-18-30-16-19-31(20-17-30)41-27-13-9-11-25-37(3,4)5/h15-20,22-24H,9-14,21,25-28H2,1-8H3/q+1/p+1/b23-18+ |
| InChIKey | IJPMHQICEXYUSN-PTGBLXJZSA-O |
| XLogP | 7.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|