C21H22O5 — CID 90910133
1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)propane-1,2-dione (PubChem CID 90910133) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)propane-1,2-dione.
| Compound Name | 1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)propane-1,2-dione |
|---|---|
| PubChem CID | 90910133 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)propane-1,2-dione |
| SMILES | COc1ccc(C(=O)C(=O)Cc2ccc(O)cc2)c(O)c1CC=C(C)C |
| InChI | InChI=1S/C21H22O5/c1-13(2)4-9-16-19(26-3)11-10-17(20(16)24)21(25)18(23)12-14-5-7-15(22)8-6-14/h4-8,10-11,22,24H,9,12H2,1-3H3 |
| InChIKey | FBRNUJRIORUPTB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|