C12H16O2 — CID 101027686
4-methoxy-3-(3-methylbut-2-enyl)phenol (PubChem CID 101027686) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-methoxy-3-(3-methylbut-2-enyl)phenol.
| Compound Name | 4-methoxy-3-(3-methylbut-2-enyl)phenol |
|---|---|
| PubChem CID | 101027686 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 4-methoxy-3-(3-methylbut-2-enyl)phenol |
| SMILES | COc1ccc(O)cc1CC=C(C)C |
| InChI | InChI=1S/C12H16O2/c1-9(2)4-5-10-8-11(13)6-7-12(10)14-3/h4,6-8,13H,5H2,1-3H3 |
| InChIKey | AMRHDANHZOKNBL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|