C21H22O4 — CID 162978049
9-methoxy-8-(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol (PubChem CID 162978049) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is 9-methoxy-8-(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol.
| Compound Name | 9-methoxy-8-(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol |
|---|---|
| PubChem CID | 162978049 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 9-methoxy-8-(3-methylbut-2-enyl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol |
| SMILES | COc1cc2c(cc1CC=C(C)C)C1COc3cc(O)ccc3C1O2 |
| InChI | InChI=1S/C21H22O4/c1-12(2)4-5-13-8-16-17-11-24-19-9-14(22)6-7-15(19)21(17)25-20(16)10-18(13)23-3/h4,6-10,17,21-22H,5,11H2,1-3H3 |
| InChIKey | PTLWUVYNMMFIEH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|