C21H24O3 — CID 78200712
4-[2-[3,5-dimethoxy-4-(3-methylbut-2-enyl)phenyl]ethenyl]phenol (PubChem CID 78200712) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-[2-[3,5-dimethoxy-4-(3-methylbut-2-enyl)phenyl]ethenyl]phenol.
| Compound Name | 4-[2-[3,5-dimethoxy-4-(3-methylbut-2-enyl)phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 78200712 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-[2-[3,5-dimethoxy-4-(3-methylbut-2-enyl)phenyl]ethenyl]phenol |
| SMILES | COc1cc(C=Cc2ccc(O)cc2)cc(OC)c1CC=C(C)C |
| InChI | InChI=1S/C21H24O3/c1-15(2)5-12-19-20(23-3)13-17(14-21(19)24-4)7-6-16-8-10-18(22)11-9-16/h5-11,13-14,22H,12H2,1-4H3 |
| InChIKey | BXJBLAVSDBVABQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|