C20H23NO3 — CID 121371140
3-methoxy-5-[(E)-2-(3-methoxy-2-pyridinyl)ethenyl]-2-(3-methylbut-2-enyl)phenol (PubChem CID 121371140) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-methoxy-5-[(E)-2-(3-methoxy-2-pyridinyl)ethenyl]-2-(3-methylbut-2-enyl)phenol.
| Compound Name | 3-methoxy-5-[(E)-2-(3-methoxy-2-pyridinyl)ethenyl]-2-(3-methylbut-2-enyl)phenol |
|---|---|
| PubChem CID | 121371140 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-methoxy-5-[(E)-2-(3-methoxy-2-pyridinyl)ethenyl]-2-(3-methylbut-2-enyl)phenol |
| SMILES | COc1cccnc1/C=C/c1cc(O)c(CC=C(C)C)c(OC)c1 |
| InChI | InChI=1S/C20H23NO3/c1-14(2)7-9-16-18(22)12-15(13-20(16)24-4)8-10-17-19(23-3)6-5-11-21-17/h5-8,10-13,22H,9H2,1-4H3/b10-8+ |
| InChIKey | ZRKLTZBGGUPLQU-CSKARUKUSA-N |
| XLogP | 4.48 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|