C26H25NO3 — CID 140661571
[3-methoxy-2-(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]phenyl] pyridine-2-carboxylate (PubChem CID 140661571) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is [3-methoxy-2-(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]phenyl] pyridine-2-carboxylate.
| Compound Name | [3-methoxy-2-(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]phenyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 140661571 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [3-methoxy-2-(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]phenyl] pyridine-2-carboxylate |
| SMILES | COc1cc(/C=C/c2ccccc2)cc(OC(=O)c2ccccn2)c1CC=C(C)C |
| InChI | InChI=1S/C26H25NO3/c1-19(2)12-15-22-24(29-3)17-21(14-13-20-9-5-4-6-10-20)18-25(22)30-26(28)23-11-7-8-16-27-23/h4-14,16-18H,15H2,1-3H3/b14-13+ |
| InChIKey | XCHLAFSHLYOBIY-BUHFOSPRSA-N |
| XLogP | 5.99 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|