C24H24N2O3 — CID 123441650
[3-methoxy-2-(3-methylbut-2-enyl)-5-(2-phenylethenyl)phenyl] 1H-imidazole-5-carboxylate (PubChem CID 123441650) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is [3-methoxy-2-(3-methylbut-2-enyl)-5-(2-phenylethenyl)phenyl] 1H-imidazole-5-carboxylate.
| Compound Name | [3-methoxy-2-(3-methylbut-2-enyl)-5-(2-phenylethenyl)phenyl] 1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 123441650 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [3-methoxy-2-(3-methylbut-2-enyl)-5-(2-phenylethenyl)phenyl] 1H-imidazole-5-carboxylate |
| SMILES | COc1cc(C=Cc2ccccc2)cc(OC(=O)c2cnc[nH]2)c1CC=C(C)C |
| InChI | InChI=1S/C24H24N2O3/c1-17(2)9-12-20-22(28-3)13-19(11-10-18-7-5-4-6-8-18)14-23(20)29-24(27)21-15-25-16-26-21/h4-11,13-16H,12H2,1-3H3,(H,25,26) |
| InChIKey | HMWUNBPBQVVPEE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|