C21H20CaO4 — CID 71509046
calcium 4-methoxy-3-(3-methylbut-2-enyl)-2-oxido-6-[(E)-2-phenylethenyl]benzoate (PubChem CID 71509046) has the molecular formula C21H20CaO4 and a molecular weight of 376.47 g/mol. Its IUPAC name is calcium 4-methoxy-3-(3-methylbut-2-enyl)-2-oxido-6-[(E)-2-phenylethenyl]benzoate.
| Compound Name | calcium 4-methoxy-3-(3-methylbut-2-enyl)-2-oxido-6-[(E)-2-phenylethenyl]benzoate |
|---|---|
| PubChem CID | 71509046 |
| Molecular Formula | C21H20CaO4 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | calcium 4-methoxy-3-(3-methylbut-2-enyl)-2-oxido-6-[(E)-2-phenylethenyl]benzoate |
| SMILES | COc1cc(/C=C/c2ccccc2)c(C(=O)[O-])c([O-])c1CC=C(C)C.[Ca+2] |
| InChI | InChI=1S/C21H22O4.Ca/c1-14(2)9-12-17-18(25-3)13-16(19(20(17)22)21(23)24)11-10-15-7-5-4-6-8-15;/h4-11,13,22H,12H2,1-3H3,(H,23,24);/q;+2/p-2/b11-10+; |
| InChIKey | QHTRSTIIIQPBOZ-ASTDGNLGSA-L |
| XLogP | 2.43 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|