C24H28O2 — CID 18546439
2,4-bis(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]benzene-1,3-diol (PubChem CID 18546439) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2,4-bis(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]benzene-1,3-diol.
| Compound Name | 2,4-bis(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 18546439 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2,4-bis(3-methylbut-2-enyl)-5-[(E)-2-phenylethenyl]benzene-1,3-diol |
| SMILES | CC(C)=CCc1c(O)cc(/C=C/c2ccccc2)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C24H28O2/c1-17(2)10-14-21-20(13-12-19-8-6-5-7-9-19)16-23(25)22(24(21)26)15-11-18(3)4/h5-13,16,25-26H,14-15H2,1-4H3/b13-12+ |
| InChIKey | WGNKBWUNUUKYBR-OUKQBFOZSA-N |
| XLogP | 6.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|