C24H28O3 — CID 162928511
2,2-dimethyl-8-(3-methylbut-2-enyl)-5-(2-phenylethenyl)-3,4-dihydrochromene-3,7-diol (PubChem CID 162928511) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2,2-dimethyl-8-(3-methylbut-2-enyl)-5-(2-phenylethenyl)-3,4-dihydrochromene-3,7-diol.
| Compound Name | 2,2-dimethyl-8-(3-methylbut-2-enyl)-5-(2-phenylethenyl)-3,4-dihydrochromene-3,7-diol |
|---|---|
| PubChem CID | 162928511 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2,2-dimethyl-8-(3-methylbut-2-enyl)-5-(2-phenylethenyl)-3,4-dihydrochromene-3,7-diol |
| SMILES | CC(C)=CCc1c(O)cc(C=Cc2ccccc2)c2c1OC(C)(C)C(O)C2 |
| InChI | InChI=1S/C24H28O3/c1-16(2)10-13-19-21(25)14-18(12-11-17-8-6-5-7-9-17)20-15-22(26)24(3,4)27-23(19)20/h5-12,14,22,25-26H,13,15H2,1-4H3 |
| InChIKey | UAXXMVQLCVNGIS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|