C19H20O3 — CID 163193809
(3R)-2,2-dimethyl-7-[(E)-2-phenylethenyl]-3,4-dihydrochromene-3,5-diol (PubChem CID 163193809) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3R)-2,2-dimethyl-7-[(E)-2-phenylethenyl]-3,4-dihydrochromene-3,5-diol.
| Compound Name | (3R)-2,2-dimethyl-7-[(E)-2-phenylethenyl]-3,4-dihydrochromene-3,5-diol |
|---|---|
| PubChem CID | 163193809 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3R)-2,2-dimethyl-7-[(E)-2-phenylethenyl]-3,4-dihydrochromene-3,5-diol |
| SMILES | CC1(C)Oc2cc(/C=C/c3ccccc3)cc(O)c2C[C@H]1O |
| InChI | InChI=1S/C19H20O3/c1-19(2)18(21)12-15-16(20)10-14(11-17(15)22-19)9-8-13-6-4-3-5-7-13/h3-11,18,20-21H,12H2,1-2H3/b9-8+/t18-/m1/s1 |
| InChIKey | HSGNBZVGNHDAMS-GFOMBABLSA-N |
| XLogP | 3.64 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|