C19H19NO4 — CID 136593307
4-[(E)-2-[3-hydroxy-2-(3-methylbut-2-enyl)-5-nitrosophenyl]ethenyl]benzene-1,2-diol (PubChem CID 136593307) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 4-[(E)-2-[3-hydroxy-2-(3-methylbut-2-enyl)-5-nitrosophenyl]ethenyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-2-[3-hydroxy-2-(3-methylbut-2-enyl)-5-nitrosophenyl]ethenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136593307 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-[(E)-2-[3-hydroxy-2-(3-methylbut-2-enyl)-5-nitrosophenyl]ethenyl]benzene-1,2-diol |
| SMILES | CC(C)=CCc1c(O)cc(N=O)cc1/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H19NO4/c1-12(2)3-7-16-14(10-15(20-24)11-18(16)22)6-4-13-5-8-17(21)19(23)9-13/h3-6,8-11,21-23H,7H2,1-2H3/b6-4+ |
| InChIKey | BWMGBOMAWVMKIB-GQCTYLIASA-N |
| XLogP | 4.88 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|