C26H38O2 — CID 91460835
2,3,5,6-tetrakis(3-methylbut-2-enyl)benzene-1,4-diol (PubChem CID 91460835) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(3-methylbut-2-enyl)benzene-1,4-diol.
| Compound Name | 2,3,5,6-tetrakis(3-methylbut-2-enyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 91460835 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 2,3,5,6-tetrakis(3-methylbut-2-enyl)benzene-1,4-diol |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c(CC=C(C)C)c(O)c1CC=C(C)C |
| InChI | InChI=1S/C26H38O2/c1-17(2)9-13-21-22(14-10-18(3)4)26(28)24(16-12-20(7)8)23(25(21)27)15-11-19(5)6/h9-12,27-28H,13-16H2,1-8H3 |
| InChIKey | SOTFTBNDPYAAPR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|