C14H18O4 — CID 91249519
2,5-dihydroxy-6-methoxy-4-methyl-3-(3-methylbut-2-enyl)benzaldehyde (PubChem CID 91249519) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2,5-dihydroxy-6-methoxy-4-methyl-3-(3-methylbut-2-enyl)benzaldehyde.
| Compound Name | 2,5-dihydroxy-6-methoxy-4-methyl-3-(3-methylbut-2-enyl)benzaldehyde |
|---|---|
| PubChem CID | 91249519 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2,5-dihydroxy-6-methoxy-4-methyl-3-(3-methylbut-2-enyl)benzaldehyde |
| SMILES | COc1c(O)c(C)c(CC=C(C)C)c(O)c1C=O |
| InChI | InChI=1S/C14H18O4/c1-8(2)5-6-10-9(3)12(16)14(18-4)11(7-15)13(10)17/h5,7,16-17H,6H2,1-4H3 |
| InChIKey | LYSURRYAIANWDO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|