C18H24O7 — CID 89003312
3-O-[4-hydroxy-2,3-dimethoxy-5-methyl-6-(3-methylbut-2-enyl)phenyl] 1-O-methyl propanedioate (PubChem CID 89003312) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is 3-O-[4-hydroxy-2,3-dimethoxy-5-methyl-6-(3-methylbut-2-enyl)phenyl] 1-O-methyl propanedioate.
| Compound Name | 3-O-[4-hydroxy-2,3-dimethoxy-5-methyl-6-(3-methylbut-2-enyl)phenyl] 1-O-methyl propanedioate |
|---|---|
| PubChem CID | 89003312 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-O-[4-hydroxy-2,3-dimethoxy-5-methyl-6-(3-methylbut-2-enyl)phenyl] 1-O-methyl propanedioate |
| SMILES | COC(=O)CC(=O)Oc1c(CC=C(C)C)c(C)c(O)c(OC)c1OC |
| InChI | InChI=1S/C18H24O7/c1-10(2)7-8-12-11(3)15(21)17(23-5)18(24-6)16(12)25-14(20)9-13(19)22-4/h7,21H,8-9H2,1-6H3 |
| InChIKey | FZQKJDRQRBQIPO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|