C27H42O6 — CID 59821515
10-O-[2,3-dimethoxy-4,5-dimethyl-6-[(E)-3-methylpent-2-enyl]phenyl] 1-O-methyl decanedioate (PubChem CID 59821515) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is 10-O-[2,3-dimethoxy-4,5-dimethyl-6-[(E)-3-methylpent-2-enyl]phenyl] 1-O-methyl decanedioate.
| Compound Name | 10-O-[2,3-dimethoxy-4,5-dimethyl-6-[(E)-3-methylpent-2-enyl]phenyl] 1-O-methyl decanedioate |
|---|---|
| PubChem CID | 59821515 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 10-O-[2,3-dimethoxy-4,5-dimethyl-6-[(E)-3-methylpent-2-enyl]phenyl] 1-O-methyl decanedioate |
| SMILES | CC/C(C)=C/Cc1c(C)c(C)c(OC)c(OC)c1OC(=O)CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C27H42O6/c1-8-19(2)17-18-22-20(3)21(4)25(31-6)27(32-7)26(22)33-24(29)16-14-12-10-9-11-13-15-23(28)30-5/h17H,8-16,18H2,1-7H3/b19-17+ |
| InChIKey | CSIJQUKRCXPUEX-HTXNQAPBSA-N |
| XLogP | 6.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|