C17H23ClO3 — CID 10566972
(E)-6-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-4-methylhex-4-enoic acid (PubChem CID 10566972) has the molecular formula C17H23ClO3 and a molecular weight of 310.82 g/mol. Its IUPAC name is (E)-6-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 10566972 |
| Molecular Formula | C17H23ClO3 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (E)-6-(5-chloro-2-methoxy-3,4,6-trimethylphenyl)-4-methylhex-4-enoic acid |
| SMILES | COc1c(C)c(C)c(Cl)c(C)c1C/C=C(\C)CCC(=O)O |
| InChI | InChI=1S/C17H23ClO3/c1-10(7-9-15(19)20)6-8-14-13(4)16(18)11(2)12(3)17(14)21-5/h6H,7-9H2,1-5H3,(H,19,20)/b10-6+ |
| InChIKey | NCPIPYZSWFATKS-UXBLZVDNSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|