C20H26O6 — CID 54088102
6-(2,5-diacetyloxy-3,4,6-trimethylphenyl)-4-methylhex-4-enoic acid (PubChem CID 54088102) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 6-(2,5-diacetyloxy-3,4,6-trimethylphenyl)-4-methylhex-4-enoic acid.
| Compound Name | 6-(2,5-diacetyloxy-3,4,6-trimethylphenyl)-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 54088102 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 6-(2,5-diacetyloxy-3,4,6-trimethylphenyl)-4-methylhex-4-enoic acid |
| SMILES | CC(=O)Oc1c(C)c(C)c(OC(C)=O)c(CC=C(C)CCC(=O)O)c1C |
| InChI | InChI=1S/C20H26O6/c1-11(8-10-18(23)24)7-9-17-14(4)19(25-15(5)21)12(2)13(3)20(17)26-16(6)22/h7H,8-10H2,1-6H3,(H,23,24) |
| InChIKey | MRXJWVCQTPTBPF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|