C30H38O4 — CID 5379593
[4-acetyloxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalen-1-yl] acetate (PubChem CID 5379593) has the molecular formula C30H38O4 and a molecular weight of 462.63 g/mol. Its IUPAC name is [4-acetyloxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalen-1-yl] acetate.
| Compound Name | [4-acetyloxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 5379593 |
| Molecular Formula | C30H38O4 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | [4-acetyloxy-2-methyl-3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]naphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)c(OC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C30H38O4/c1-20(2)12-10-13-21(3)14-11-15-22(4)18-19-26-23(5)29(33-24(6)31)27-16-8-9-17-28(27)30(26)34-25(7)32/h8-9,12,14,16-18H,10-11,13,15,19H2,1-7H3/b21-14+,22-18+ |
| InChIKey | LQOXSTKPVFKMOB-SEUYJHDCSA-N |
| XLogP | 7.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|