C43H66O4 — CID 102269714
2-methyl-1,4-bis[1-(2-methylpropoxy)ethoxy]-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene (PubChem CID 102269714) has the molecular formula C43H66O4 and a molecular weight of 647.00 g/mol. Its IUPAC name is 2-methyl-1,4-bis[1-(2-methylpropoxy)ethoxy]-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene.
| Compound Name | 2-methyl-1,4-bis[1-(2-methylpropoxy)ethoxy]-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene |
|---|---|
| PubChem CID | 102269714 |
| Molecular Formula | C43H66O4 |
| Molecular Weight | 647.00 g/mol |
| Exact Mass | 646.50 |
| IUPAC Name | 2-methyl-1,4-bis[1-(2-methylpropoxy)ethoxy]-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1c(C)c(OC(C)OCC(C)C)c2ccccc2c1OC(C)OCC(C)C |
| InChI | InChI=1S/C43H66O4/c1-30(2)18-15-19-33(7)20-16-21-34(8)22-17-23-35(9)26-27-39-36(10)42(46-37(11)44-28-31(3)4)40-24-13-14-25-41(40)43(39)47-38(12)45-29-32(5)6/h13-14,18,20,22,24-26,31-32,37-38H,15-17,19,21,23,27-29H2,1-12H3/b33-20+,34-22+,35-26+ |
| InChIKey | NRMOBJYHIYVWDI-MEOYHPHLSA-N |
| XLogP | 12.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.00 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|