C37H50O4 — CID 134474900
[2-methyl-4-propanoyloxy-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalen-1-yl] propanoate (PubChem CID 134474900) has the molecular formula C37H50O4 and a molecular weight of 558.80 g/mol. Its IUPAC name is [2-methyl-4-propanoyloxy-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalen-1-yl] propanoate.
| Compound Name | [2-methyl-4-propanoyloxy-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalen-1-yl] propanoate |
|---|---|
| PubChem CID | 134474900 |
| Molecular Formula | C37H50O4 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.37 |
| IUPAC Name | [2-methyl-4-propanoyloxy-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalen-1-yl] propanoate |
| SMILES | CCC(=O)Oc1c(C)c(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)c(OC(=O)CC)c2ccccc12 |
| InChI | InChI=1S/C37H50O4/c1-9-34(38)40-36-30(8)31(37(41-35(39)10-2)33-23-12-11-22-32(33)36)25-24-29(7)21-15-20-28(6)19-14-18-27(5)17-13-16-26(3)4/h11-12,16,18,20,22-24H,9-10,13-15,17,19,21,25H2,1-8H3/b27-18+,28-20+,29-24+ |
| InChIKey | CJKRWFUUXAIBRZ-YZEPQMHDSA-N |
| XLogP | 10.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|