C50H72O4 — CID 135190881
[4-acetyloxy-3-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22-hexaenyl]-2-methylnaphthalen-1-yl] acetate (PubChem CID 135190881) has the molecular formula C50H72O4 and a molecular weight of 737.12 g/mol. Its IUPAC name is [4-acetyloxy-3-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22-hexaenyl]-2-methylnaphthalen-1-yl] acetate.
| Compound Name | [4-acetyloxy-3-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22-hexaenyl]-2-methylnaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 135190881 |
| Molecular Formula | C50H72O4 |
| Molecular Weight | 737.12 g/mol |
| Exact Mass | 736.54 |
| IUPAC Name | [4-acetyloxy-3-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22-hexaenyl]-2-methylnaphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCCC(C)C)c(OC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C50H72O4/c1-36(2)20-14-21-37(3)22-15-23-38(4)24-16-25-39(5)26-17-27-40(6)28-18-29-41(7)30-19-31-42(8)34-35-46-43(9)49(53-44(10)51)47-32-12-13-33-48(47)50(46)54-45(11)52/h12-13,22,24,26,28,30,32-34,36H,14-21,23,25,27,29,31,35H2,1-11H3/b37-22+,38-24+,39-26+,40-28+,41-30+,42-34+ |
| InChIKey | GCOWFRKEFQSHIJ-ZYRDWHQOSA-N |
| XLogP | 14.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.12 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|