C33H50O3 — CID 130404620
[4-hydroxy-3-methyl-2-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-yl] acetate (PubChem CID 130404620) has the molecular formula C33H50O3 and a molecular weight of 494.76 g/mol. Its IUPAC name is [4-hydroxy-3-methyl-2-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-yl] acetate.
| Compound Name | [4-hydroxy-3-methyl-2-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 130404620 |
| Molecular Formula | C33H50O3 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | [4-hydroxy-3-methyl-2-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(C/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)c(C)c(O)c2ccccc12 |
| InChI | InChI=1S/C33H50O3/c1-23(2)13-10-14-24(3)15-11-16-25(4)17-12-18-26(5)21-22-29-27(6)32(35)30-19-8-9-20-31(30)33(29)36-28(7)34/h8-9,19-21,23-25,35H,10-18,22H2,1-7H3/b26-21+/t24-,25-/m1/s1 |
| InChIKey | GDYRZEOGGPHQAH-LDKDYMQTSA-N |
| XLogP | 9.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|