C26H44O2 — CID 19863840
3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]benzene-1,2-diol (PubChem CID 19863840) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is 3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]benzene-1,2-diol.
| Compound Name | 3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 19863840 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]benzene-1,2-diol |
| SMILES | C/C(=C\Cc1cccc(O)c1O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H44O2/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)18-19-24-16-9-17-25(27)26(24)28/h9,16-18,20-22,27-28H,6-8,10-15,19H2,1-5H3/b23-18+ |
| InChIKey | ZHDHREQWJIYHGE-PTGBLXJZSA-N |
| XLogP | 8.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|