C26H44S — CID 59671970
[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbenzene (PubChem CID 59671970) has the molecular formula C26H44S and a molecular weight of 388.71 g/mol. Its IUPAC name is [(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbenzene.
| Compound Name | [(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 59671970 |
| Molecular Formula | C26H44S |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | [(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylbenzene |
| SMILES | C/C(=C\CSc1ccccc1)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H44S/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26-18-7-6-8-19-26/h6-8,18-20,22-24H,9-17,21H2,1-5H3/b25-20+ |
| InChIKey | CBJRLYQRROFUAO-LKUDQCMESA-N |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|