C31H52N2O — CID 69178839
phenyl-[4-(3,7,11,15-tetramethylhexadec-2-enyl)piperazin-1-yl]methanone (PubChem CID 69178839) has the molecular formula C31H52N2O and a molecular weight of 468.77 g/mol. Its IUPAC name is phenyl-[4-(3,7,11,15-tetramethylhexadec-2-enyl)piperazin-1-yl]methanone.
| Compound Name | phenyl-[4-(3,7,11,15-tetramethylhexadec-2-enyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 69178839 |
| Molecular Formula | C31H52N2O |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.41 |
| IUPAC Name | phenyl-[4-(3,7,11,15-tetramethylhexadec-2-enyl)piperazin-1-yl]methanone |
| SMILES | CC(=CCN1CCN(C(=O)c2ccccc2)CC1)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C31H52N2O/c1-26(2)12-9-13-27(3)14-10-15-28(4)16-11-17-29(5)20-21-32-22-24-33(25-23-32)31(34)30-18-7-6-8-19-30/h6-8,18-20,26-28H,9-17,21-25H2,1-5H3 |
| InChIKey | ISCYQODUPATTTG-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|