C27H44O3 — CID 141183954
[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] 2-hydroxybenzoate (PubChem CID 141183954) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] 2-hydroxybenzoate.
| Compound Name | [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 141183954 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | [(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl] 2-hydroxybenzoate |
| SMILES | C/C(=C\COC(=O)c1ccccc1O)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C27H44O3/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)19-20-30-27(29)25-17-6-7-18-26(25)28/h6-7,17-19,21-23,28H,8-16,20H2,1-5H3/b24-19+/t22-,23-/m1/s1 |
| InChIKey | GYWADCOTVTUXHC-OLOZJIBXSA-N |
| XLogP | 7.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|