C17H24S — CID 101174160
[(2E)-3,8-dimethylnona-2,7-dienyl]sulfanylbenzene (PubChem CID 101174160) has the molecular formula C17H24S and a molecular weight of 260.45 g/mol. Its IUPAC name is [(2E)-3,8-dimethylnona-2,7-dienyl]sulfanylbenzene.
| Compound Name | [(2E)-3,8-dimethylnona-2,7-dienyl]sulfanylbenzene |
|---|---|
| PubChem CID | 101174160 |
| Molecular Formula | C17H24S |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [(2E)-3,8-dimethylnona-2,7-dienyl]sulfanylbenzene |
| SMILES | CC(C)=CCCC/C(C)=C/CSc1ccccc1 |
| InChI | InChI=1S/C17H24S/c1-15(2)9-7-8-10-16(3)13-14-18-17-11-5-4-6-12-17/h4-6,9,11-13H,7-8,10,14H2,1-3H3/b16-13+ |
| InChIKey | WJPRCAGQQKAWIJ-DTQAZKPQSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|