C38H46O4S3 — CID 69118499
[5,9-bis(benzenesulfonyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylbenzene (PubChem CID 69118499) has the molecular formula C38H46O4S3 and a molecular weight of 662.98 g/mol. Its IUPAC name is [5,9-bis(benzenesulfonyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylbenzene.
| Compound Name | [5,9-bis(benzenesulfonyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylbenzene |
|---|---|
| PubChem CID | 69118499 |
| Molecular Formula | C38H46O4S3 |
| Molecular Weight | 662.98 g/mol |
| Exact Mass | 662.26 |
| IUPAC Name | [5,9-bis(benzenesulfonyl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylbenzene |
| SMILES | CC(C)=CCCC(C)=CC(CC(C)=CC(CC(C)=CCSc1ccccc1)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C38H46O4S3/c1-30(2)16-15-17-31(3)26-37(44(39,40)35-20-11-7-12-21-35)28-33(5)29-38(45(41,42)36-22-13-8-14-23-36)27-32(4)24-25-43-34-18-9-6-10-19-34/h6-14,16,18-24,26,29,37-38H,15,17,25,27-28H2,1-5H3 |
| InChIKey | XZBSDHNCUSMBRC-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.98 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|