C21H30O3S — CID 564477
9-(benzenesulfonyl)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol (PubChem CID 564477) has the molecular formula C21H30O3S and a molecular weight of 362.54 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol.
| Compound Name | 9-(benzenesulfonyl)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 564477 |
| Molecular Formula | C21H30O3S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 9-(benzenesulfonyl)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| SMILES | CC(C)=CC(CC(C)=CCCC(C)=CCO)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H30O3S/c1-17(2)15-21(25(23,24)20-11-6-5-7-12-20)16-19(4)10-8-9-18(3)13-14-22/h5-7,10-13,15,21-22H,8-9,14,16H2,1-4H3 |
| InChIKey | QFDXZSAOHRHYSQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|