C40H65BrO2S — CID 144605858
[(2E,6E,10E,14E,18E)-1-bromo-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-12-yl]sulfonylbenzene;ethane (PubChem CID 144605858) has the molecular formula C40H65BrO2S and a molecular weight of 689.93 g/mol. Its IUPAC name is [(2E,6E,10E,14E,18E)-1-bromo-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-12-yl]sulfonylbenzene;ethane.
| Compound Name | [(2E,6E,10E,14E,18E)-1-bromo-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-12-yl]sulfonylbenzene;ethane |
|---|---|
| PubChem CID | 144605858 |
| Molecular Formula | C40H65BrO2S |
| Molecular Weight | 689.93 g/mol |
| Exact Mass | 688.39 |
| IUPAC Name | [(2E,6E,10E,14E,18E)-1-bromo-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-12-yl]sulfonylbenzene;ethane |
| SMILES | CC.CC.CC(C)=CCC/C(C)=C/CC/C(C)=C/CC(/C(C)=C/CC/C(C)=C/CC/C(C)=C/CBr)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H53BrO2S.2C2H6/c1-29(2)15-11-16-30(3)17-12-19-32(5)25-26-36(40(38,39)35-23-9-8-10-24-35)34(7)22-14-21-31(4)18-13-20-33(6)27-28-37;2*1-2/h8-10,15,17-18,22-25,27,36H,11-14,16,19-21,26,28H2,1-7H3;2*1-2H3/b30-17+,31-18+,32-25+,33-27+,34-22+;; |
| InChIKey | BJXRCLFPICLHFD-LEGJSDMUSA-N |
| XLogP | 13.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.93 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|