C16H22O3S — CID 13130131
(2E)-4-(benzenesulfonyl)-3,7-dimethylocta-2,6-dien-1-ol (PubChem CID 13130131) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (2E)-4-(benzenesulfonyl)-3,7-dimethylocta-2,6-dien-1-ol.
| Compound Name | (2E)-4-(benzenesulfonyl)-3,7-dimethylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 13130131 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2E)-4-(benzenesulfonyl)-3,7-dimethylocta-2,6-dien-1-ol |
| SMILES | CC(C)=CCC(/C(C)=C/CO)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O3S/c1-13(2)9-10-16(14(3)11-12-17)20(18,19)15-7-5-4-6-8-15/h4-9,11,16-17H,10,12H2,1-3H3/b14-11+ |
| InChIKey | WULBSJPWBQJPFN-SDNWHVSQSA-N |
| XLogP | 3.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|