C11H20O — CID 129379674
(2Z,4S)-3,4,7-trimethylocta-2,6-dien-1-ol (PubChem CID 129379674) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (2Z,4S)-3,4,7-trimethylocta-2,6-dien-1-ol.
| Compound Name | (2Z,4S)-3,4,7-trimethylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 129379674 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (2Z,4S)-3,4,7-trimethylocta-2,6-dien-1-ol |
| SMILES | CC(C)=CC[C@H](C)/C(C)=C\CO |
| InChI | InChI=1S/C11H20O/c1-9(2)5-6-10(3)11(4)7-8-12/h5,7,10,12H,6,8H2,1-4H3/b11-7-/t10-/m0/s1 |
| InChIKey | ZPIKDJYPRJOHLN-QBQSQJOESA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|