C11H20O — CID 118393642
5,8-dimethylnon-7-en-4-one (PubChem CID 118393642) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 5,8-dimethylnon-7-en-4-one.
| Compound Name | 5,8-dimethylnon-7-en-4-one |
|---|---|
| PubChem CID | 118393642 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 5,8-dimethylnon-7-en-4-one |
| SMILES | CCCC(=O)C(C)CC=C(C)C |
| InChI | InChI=1S/C11H20O/c1-5-6-11(12)10(4)8-7-9(2)3/h7,10H,5-6,8H2,1-4H3 |
| InChIKey | VVWKUGGSJVYEPC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|