About 3-methyl-4-oxoheptanoic acid
3-methyl-4-oxoheptanoic acid (PubChem CID 19914762) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-methyl-4-oxoheptanoic acid.
Molecular Properties
| Compound Name | 3-methyl-4-oxoheptanoic acid |
| PubChem CID | 19914762 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3-methyl-4-oxoheptanoic acid |
| SMILES | CCCC(=O)C(C)CC(=O)O |
| InChI | InChI=1S/C8H14O3/c1-3-4-7(9)6(2)5-8(10)11/h6H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | JEUZJZNILRNEHA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-4-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-oxoheptanoic acid?
The IUPAC name of 3-methyl-4-oxoheptanoic acid (CID 19914762) is 3-methyl-4-oxoheptanoic acid.
What is the SMILES notation for 3-methyl-4-oxoheptanoic acid?
The canonical SMILES for 3-methyl-4-oxoheptanoic acid is CCCC(=O)C(C)CC(=O)O.
What is the InChIKey of 3-methyl-4-oxoheptanoic acid?
The InChIKey is JEUZJZNILRNEHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-4-7(9)6(2)5-8(10)11/h6H,3-5H2,1-2H3,(H,10,11).
What are the key properties of 3-methyl-4-oxoheptanoic acid?
3-methyl-4-oxoheptanoic acid has a molecular weight of 158.20 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-oxoheptanoic acid is sourced from PubChem (CID 19914762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).