About diiminoazanium;3-methylheptan-4-one
diiminoazanium;3-methylheptan-4-one (PubChem CID 175383752) has the molecular formula C8H18N3O+
and a molecular weight of 172.25 g/mol. Its IUPAC name is diiminoazanium;3-methylheptan-4-one.
Molecular Properties
| Compound Name | diiminoazanium;3-methylheptan-4-one |
| PubChem CID | 175383752 |
| Molecular Formula | C8H18N3O+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | diiminoazanium;3-methylheptan-4-one |
| SMILES | CCCC(=O)C(C)CC.N=[N+]=N |
| InChI | InChI=1S/C8H16O.H2N3/c1-4-6-8(9)7(3)5-2;1-3-2/h7H,4-6H2,1-3H3;1-2H/q;+1 |
| InChIKey | IWYCISRBFNMSCD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze diiminoazanium;3-methylheptan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiminoazanium;3-methylheptan-4-one?
The IUPAC name of diiminoazanium;3-methylheptan-4-one (CID 175383752) is diiminoazanium;3-methylheptan-4-one.
What is the SMILES notation for diiminoazanium;3-methylheptan-4-one?
The canonical SMILES for diiminoazanium;3-methylheptan-4-one is CCCC(=O)C(C)CC.N=[N+]=N.
What is the InChIKey of diiminoazanium;3-methylheptan-4-one?
The InChIKey is IWYCISRBFNMSCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.H2N3/c1-4-6-8(9)7(3)5-2;1-3-2/h7H,4-6H2,1-3H3;1-2H/q;+1.
What are the key properties of diiminoazanium;3-methylheptan-4-one?
diiminoazanium;3-methylheptan-4-one has a molecular weight of 172.25 g/mol, XLogP of 2.52, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diiminoazanium;3-methylheptan-4-one is sourced from PubChem (CID 175383752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).